CAS 57000-78-9 is the registry number for 1-Chloro-1-(4-chlorophenoxy)-3,3-dimethylbutan-2-one. Offered by: Chemat. Available pack sizes: 100g.
1-chloro-1-(4-chlorophenoxy)-3,3-dimethylbutan-2-one (CAS 57000-78-9) is a chemical compound with the molecular formula C12H14Cl2O2 and a molecular weight of 261.14 g/mol. IUPAC name: 1-chloro-1-(4-chlorophenoxy)-3,3-dimethylbutan-2-one. InChIKey: SJEOCSMLOPQAFS-UHFFFAOYSA-N.
| Molecular formula | C12H14Cl2O2 |
|---|---|
| Molecular weight | 261.14 g/mol |
| IUPAC name | 1-chloro-1-(4-chlorophenoxy)-3,3-dimethylbutan-2-one |
| InChIKey | SJEOCSMLOPQAFS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)C(OC1=CC=C(C=C1)Cl)Cl |
Computed by PubChem (NCBI)