CAS 57022-97-6 is the registry number for 3-Chloro-4,5-diphenyl-4H-1,2,4-triazole, 95%. Offered by: AmBeed. Available pack sizes: 10g.
3-chloro-4,5-diphenyl-1,2,4-triazole (CAS 57022-97-6) is a chemical compound with the molecular formula C14H10ClN3 and a molecular weight of 255.70 g/mol. IUPAC name: 3-chloro-4,5-diphenyl-1,2,4-triazole. InChIKey: ZLIFHMDKLFUZQJ-UHFFFAOYSA-N.
| Molecular formula | C14H10ClN3 |
|---|---|
| Molecular weight | 255.70 g/mol |
| IUPAC name | 3-chloro-4,5-diphenyl-1,2,4-triazole |
| InChIKey | ZLIFHMDKLFUZQJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NN=C(N2C3=CC=CC=C3)Cl |
Computed by PubChem (NCBI)