CAS 88032-10-4 is the registry number for 5-(2-Chlorophenyl)-1-phenyl-1,3,4-triazole, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 1g, 250mg.
3-(2-chlorophenyl)-4-phenyl-1,2,4-triazole (CAS 88032-10-4) is a chemical compound with the molecular formula C14H10ClN3 and a molecular weight of 255.70 g/mol. IUPAC name: 3-(2-chlorophenyl)-4-phenyl-1,2,4-triazole. InChIKey: HKSDKHILVJHUEF-UHFFFAOYSA-N.
| Molecular formula | C14H10ClN3 |
|---|---|
| Molecular weight | 255.70 g/mol |
| IUPAC name | 3-(2-chlorophenyl)-4-phenyl-1,2,4-triazole |
| InChIKey | HKSDKHILVJHUEF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C=NN=C2C3=CC=CC=C3Cl |
Computed by PubChem (NCBI)