Products 750598-94-8
CAS 750598-94-8 is the registry number for 13-Chloro-11-ethyl-1,8-diazatricyclo(7.4.0.0,2,7)trideca-2,4,6,8,10,12-hexaene-10-carbonitrile. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
1-chloro-3-ethylpyrido[1,2-a]benzimidazole-4-carbonitrile (CAS 750598-94-8) is a chemical compound with the molecular formula C14H10ClN3 and a molecular weight of 255.70 g/mol. IUPAC name: 1-chloro-3-ethylpyrido[1,2-a]benzimidazole-4-carbonitrile. InChIKey: CUUJDAUMFHOCNP-UHFFFAOYSA-N.
| Molecular formula | C14H10ClN3 |
|---|---|
| Molecular weight | 255.70 g/mol |
| IUPAC name | 1-chloro-3-ethylpyrido[1,2-a]benzimidazole-4-carbonitrile |
| InChIKey | CUUJDAUMFHOCNP-UHFFFAOYSA-N |
| SMILES | CCC1=C(C2=NC3=CC=CC=C3N2C(=C1)Cl)C#N |
Computed by PubChem (NCBI)