CAS 5711-61-5 appears in our catalog under these names: 5-(4-Methoxyphenyl)-1,3,4-oxadiazol-2-amine, 95%, 5-(4-Methoxyphenyl)-1,3,4-oxadiazol-2-amine, 95-<97%, 2-Amino-5-(4-methoxyphenyl)-1,3,4-oxadiazole, 95%, 5-(4-Methoxyphenyl)-1,3,4-oxadiazol-2-amine, 95%, 95%. Offered by: Combi-blocks, Hoffman Fine Chemicals, AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 25g, 50g, 100g, 200g, 300g.
5-(4-methoxyphenyl)-1,3,4-oxadiazol-2-amine (CAS 5711-61-5) is a chemical compound with the molecular formula C9H9N3O2 and a molecular weight of 191.19 g/mol. IUPAC name: 5-(4-methoxyphenyl)-1,3,4-oxadiazol-2-amine. InChIKey: IEJVXWOVBNWQCY-UHFFFAOYSA-N.
| Molecular formula | C9H9N3O2 |
|---|---|
| Molecular weight | 191.19 g/mol |
| IUPAC name | 5-(4-methoxyphenyl)-1,3,4-oxadiazol-2-amine |
| InChIKey | IEJVXWOVBNWQCY-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=NN=C(O2)N |
Computed by PubChem (NCBI)