Products 57145-23-0
CAS 57145-23-0 appears in our catalog under these names: 2,2-Dimethyl-3-p-tolylpropanoic acid, 95%, 2,2-Dimethyl-3-(p-tolyl)propanoic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 100mg.
2,2-dimethyl-3-(4-methylphenyl)propanoic acid (CAS 57145-23-0) is a chemical compound with the molecular formula C12H16O2 and a molecular weight of 192.25 g/mol. IUPAC name: 2,2-dimethyl-3-(4-methylphenyl)propanoic acid. InChIKey: KIYYROCEXSXMIW-UHFFFAOYSA-N.
| Molecular formula | C12H16O2 |
|---|---|
| Molecular weight | 192.25 g/mol |
| IUPAC name | 2,2-dimethyl-3-(4-methylphenyl)propanoic acid |
| InChIKey | KIYYROCEXSXMIW-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)CC(C)(C)C(=O)O |
Computed by PubChem (NCBI)