CAS 5722-94-1 appears in our catalog under these names: 3,4-Dimethoxy-2-methylbenzoic acid, 95%, 3,4-Dimethoxy-2-methylbenzoic acid, 95-<97%, 3,4-Dimethoxy-2-methylbenzoic acid, ≥97-<99%, 3,4-Dimethoxy-2-methylbenzoic acid, 96%, 3,4-Dimethoxy-2-methylbenzoic Acid. Offered by: Combi-blocks, Hoffman Fine Chemicals, AmBeed, TRC, GLPBio. Available pack sizes: 1g, 250mg, 10g, 25g, 50g, 100g, 200g, 300g.
3,4-dimethoxy-2-methylbenzoic acid (CAS 5722-94-1) is a chemical compound with the molecular formula C10H12O4 and a molecular weight of 196.20 g/mol. IUPAC name: 3,4-dimethoxy-2-methylbenzoic acid. InChIKey: OUEJXYZKZCQELU-UHFFFAOYSA-N.
| Molecular formula | C10H12O4 |
|---|---|
| Molecular weight | 196.20 g/mol |
| IUPAC name | 3,4-dimethoxy-2-methylbenzoic acid |
| InChIKey | OUEJXYZKZCQELU-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1OC)OC)C(=O)O |
Computed by PubChem (NCBI)