CAS 5728-70-1 is the registry number for 4'-Ethyl-4-biphenylamine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
4-(4-ethylphenyl)aniline (CAS 5728-70-1) is a chemical compound with the molecular formula C14H15N and a molecular weight of 197.27 g/mol. IUPAC name: 4-(4-ethylphenyl)aniline. InChIKey: NMCSKBJWADPKPK-UHFFFAOYSA-N.
| Molecular formula | C14H15N |
|---|---|
| Molecular weight | 197.27 g/mol |
| IUPAC name | 4-(4-ethylphenyl)aniline |
| InChIKey | NMCSKBJWADPKPK-UHFFFAOYSA-N |
| SMILES | CCC1=CC=C(C=C1)C2=CC=C(C=C2)N |
Computed by PubChem (NCBI)