Products 57281-77-3
CAS 57281-77-3 is the registry number for 3-Methoxy-4-methyl-2-nitrobenzoic acid, 95+%. Offered by: AmBeed. Available pack sizes: 5g.
3-methoxy-4-methyl-2-nitrobenzoic acid (CAS 57281-77-3) is a chemical compound with the molecular formula C9H9NO5 and a molecular weight of 211.17 g/mol. IUPAC name: 3-methoxy-4-methyl-2-nitrobenzoic acid. InChIKey: PJEQOQBIFDMSON-UHFFFAOYSA-N.
| Molecular formula | C9H9NO5 |
|---|---|
| Molecular weight | 211.17 g/mol |
| IUPAC name | 3-methoxy-4-methyl-2-nitrobenzoic acid |
| InChIKey | PJEQOQBIFDMSON-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C=C1)C(=O)O)[N+](=O)[O-])OC |
Computed by PubChem (NCBI)