CAS 5729-18-0 appears in our catalog under these names: 1-N-((4-Chlorophenyl)methyl)benzene-1,2-diamine, 95%, 1-N-((4-Chlorophenyl)methyl)benzene-1,2-diamine. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 2,5g.
2-N-[(4-chlorophenyl)methyl]benzene-1,2-diamine (CAS 5729-18-0) is a chemical compound with the molecular formula C13H13ClN2 and a molecular weight of 232.71 g/mol. IUPAC name: 2-N-[(4-chlorophenyl)methyl]benzene-1,2-diamine. InChIKey: NEXXSABNSYGLLU-UHFFFAOYSA-N.
| Molecular formula | C13H13ClN2 |
|---|---|
| Molecular weight | 232.71 g/mol |
| IUPAC name | 2-N-[(4-chlorophenyl)methyl]benzene-1,2-diamine |
| InChIKey | NEXXSABNSYGLLU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)N)NCC2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)