CAS 5730-85-8 appears in our catalog under these names: 2-Chloro-biphenyl-4-ylamine, 95%, 2-Chloro-(1,1'-biphenyl)-4-amine, 95+%, 3-Chloro-4-phenylaniline, ≥95%, ≥95%, 2-Chloro-biphenyl-4-ylamine. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 10g, 25g, 5g, 1g, 250mg.
3-chloro-4-phenylaniline (CAS 5730-85-8) is a chemical compound with the molecular formula C12H10ClN and a molecular weight of 203.67 g/mol. IUPAC name: 3-chloro-4-phenylaniline. InChIKey: YDYUIJXAGCGIKW-UHFFFAOYSA-N.
| Molecular formula | C12H10ClN |
|---|---|
| Molecular weight | 203.67 g/mol |
| IUPAC name | 3-chloro-4-phenylaniline |
| InChIKey | YDYUIJXAGCGIKW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(C=C(C=C2)N)Cl |
Computed by PubChem (NCBI)