CAS 7285-66-7 appears in our catalog under these names: 3-Chloro-biphenyl-4-ylamine, 95%, 3-Chloro-[1,1'-biphenyl]-4-amine 95%, 3-Chloro-[1,1'-biphenyl]-4-amine, 95%, 95%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 25g, 1g, 250mg, 100mg.
2-chloro-4-phenylaniline (CAS 7285-66-7) is a chemical compound with the molecular formula C12H10ClN and a molecular weight of 203.67 g/mol. IUPAC name: 2-chloro-4-phenylaniline. InChIKey: YYLYBPJQUOYBQN-UHFFFAOYSA-N.
| Molecular formula | C12H10ClN |
|---|---|
| Molecular weight | 203.67 g/mol |
| IUPAC name | 2-chloro-4-phenylaniline |
| InChIKey | YYLYBPJQUOYBQN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=C(C=C2)N)Cl |
Computed by PubChem (NCBI)