CAS 74714-04-8 is the registry number for 2-Benzyl-6-chloropyridine, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
2-benzyl-6-chloropyridine (CAS 74714-04-8) is a chemical compound with the molecular formula C12H10ClN and a molecular weight of 203.67 g/mol. IUPAC name: 2-benzyl-6-chloropyridine. InChIKey: DQRSGDVQDDLJGP-UHFFFAOYSA-N.
| Molecular formula | C12H10ClN |
|---|---|
| Molecular weight | 203.67 g/mol |
| IUPAC name | 2-benzyl-6-chloropyridine |
| InChIKey | DQRSGDVQDDLJGP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC2=NC(=CC=C2)Cl |
Computed by PubChem (NCBI)