Products 57357-84-3
CAS 57357-84-3 is the registry number for 1-{2,6,6-trimethylbicyclo[3.1.1]heptan-3-yl}methanamine hydrochloride. Offered by: Chemat. Available pack sizes: 250mg.
[(1S,2S,3S,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]methanamine;hydrochloride (CAS 57357-84-3) is a chemical compound with the molecular formula C11H22ClN and a molecular weight of 203.75 g/mol. IUPAC name: [(1S,2S,3S,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]methanamine;hydrochloride. InChIKey: WMWWUXCZAWKORS-AVBROYKKSA-N.
| Molecular formula | C11H22ClN |
|---|---|
| Molecular weight | 203.75 g/mol |
| IUPAC name | [(1S,2S,3S,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]methanamine;hydrochloride |
| InChIKey | WMWWUXCZAWKORS-AVBROYKKSA-N |
| SMILES | C[C@@H]1[C@H](C[C@H]2C[C@@H]1C2(C)C)CN.Cl |
Computed by PubChem (NCBI)