CAS 57368-83-9 appears in our catalog under these names: 1-(Chloroacetyl)-6-methyl-1,2,3,4-tetrahydroquinoline, 95%, 2-Chloro-1-(6-methyl-1,2,3,4-tetrahydroquinolin-1-yl)ethan-1-one. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 2,5g.
2-chloro-1-(6-methyl-3,4-dihydro-2H-quinolin-1-yl)ethanone (CAS 57368-83-9) is a chemical compound with the molecular formula C12H14ClNO and a molecular weight of 223.70 g/mol. IUPAC name: 2-chloro-1-(6-methyl-3,4-dihydro-2H-quinolin-1-yl)ethanone. InChIKey: YEQHPVJKRJVMAC-UHFFFAOYSA-N.
| Molecular formula | C12H14ClNO |
|---|---|
| Molecular weight | 223.70 g/mol |
| IUPAC name | 2-chloro-1-(6-methyl-3,4-dihydro-2H-quinolin-1-yl)ethanone |
| InChIKey | YEQHPVJKRJVMAC-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)N(CCC2)C(=O)CCl |
Computed by PubChem (NCBI)