Products 573759-05-4
CAS 573759-05-4 is the registry number for 2-(Trifluoromethyl)-1,3-benzoxazol-4-amine. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
2-(trifluoromethyl)-1,3-benzoxazol-4-amine (CAS 573759-05-4) is a chemical compound with the molecular formula C8H5F3N2O and a molecular weight of 202.13 g/mol. IUPAC name: 2-(trifluoromethyl)-1,3-benzoxazol-4-amine. InChIKey: FXORYKCMDPURQG-UHFFFAOYSA-N.
| Molecular formula | C8H5F3N2O |
|---|---|
| Molecular weight | 202.13 g/mol |
| IUPAC name | 2-(trifluoromethyl)-1,3-benzoxazol-4-amine |
| InChIKey | FXORYKCMDPURQG-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C(=C1)OC(=N2)C(F)(F)F)N |
Computed by PubChem (NCBI)