Products 574-09-4
CAS 574-09-4 appears in our catalog under these names: Benzoin ethyl ether, 98%, Benzoin ethyl ether, 99% HPLC, Benzoin ethyl ether, Benzoin Ethyl Ether, >99.0%(GC), BENZOIN ETHYL ETHER, 97%. Offered by: Combi-blocks, AmBeed, GLPBio, TCI, Sigma-Aldrich. Available pack sizes: 1g, 25g, 5g, 100g, 250g, 500g, 50g, 5 g.
2-ethoxy-1,2-diphenylethanone (CAS 574-09-4) is a chemical compound with the molecular formula C16H16O2 and a molecular weight of 240.30 g/mol. IUPAC name: 2-ethoxy-1,2-diphenylethanone. InChIKey: KMNCBSZOIQAUFX-UHFFFAOYSA-N.
| Molecular formula | C16H16O2 |
|---|---|
| Molecular weight | 240.30 g/mol |
| IUPAC name | 2-ethoxy-1,2-diphenylethanone |
| InChIKey | KMNCBSZOIQAUFX-UHFFFAOYSA-N |
| SMILES | CCOC(C1=CC=CC=C1)C(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)