Products 57475-26-0
CAS 57475-26-0 is the registry number for rac-Ethyl (3aR,7aS)-2-oxo-octahydro-1H-indole-3a-carboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Ethyl (3aR,7aS)-2-oxo-3,4,5,6,7,7a-hexahydro-1H-indole-3a-carboxylate (CAS 57475-26-0) is a chemical compound with the molecular formula C11H17NO3 and a molecular weight of 211.26 g/mol. IUPAC name: ethyl (3aR,7aS)-2-oxo-3,4,5,6,7,7a-hexahydro-1H-indole-3a-carboxylate. InChIKey: FAEDUNZRSLYJCJ-GZMMTYOYSA-N.
| Molecular formula | C11H17NO3 |
|---|---|
| Molecular weight | 211.26 g/mol |
| IUPAC name | ethyl (3aR,7aS)-2-oxo-3,4,5,6,7,7a-hexahydro-1H-indole-3a-carboxylate |
| InChIKey | FAEDUNZRSLYJCJ-GZMMTYOYSA-N |
| SMILES | CCOC(=O)[C@@]12CCCC[C@@H]1NC(=O)C2 |
Computed by PubChem (NCBI)