CAS 57486-71-2 appears in our catalog under these names: Methyl 2-(3,4-dimethylphenyl)acetate, 98%, Benzeneacetic acid, 3,4-dimethyl-, methyl ester. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 2,5g, 250mg.
Methyl 2-(3,4-dimethylphenyl)acetate (CAS 57486-71-2) is a chemical compound with the molecular formula C11H14O2 and a molecular weight of 178.23 g/mol. IUPAC name: methyl 2-(3,4-dimethylphenyl)acetate. InChIKey: YOOQHVXUOFXSEN-UHFFFAOYSA-N.
| Molecular formula | C11H14O2 |
|---|---|
| Molecular weight | 178.23 g/mol |
| IUPAC name | methyl 2-(3,4-dimethylphenyl)acetate |
| InChIKey | YOOQHVXUOFXSEN-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)CC(=O)OC)C |
Computed by PubChem (NCBI)