CAS 57557-65-0 is the registry number for 1-(Phenylsulfanyl)cyclopentane-1-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-phenylsulfanylcyclopentane-1-carboxylic acid (CAS 57557-65-0) is a chemical compound with the molecular formula C12H14O2S and a molecular weight of 222.31 g/mol. IUPAC name: 1-phenylsulfanylcyclopentane-1-carboxylic acid. InChIKey: UZNNSIJKERNYGE-UHFFFAOYSA-N.
| Molecular formula | C12H14O2S |
|---|---|
| Molecular weight | 222.31 g/mol |
| IUPAC name | 1-phenylsulfanylcyclopentane-1-carboxylic acid |
| InChIKey | UZNNSIJKERNYGE-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)(C(=O)O)SC2=CC=CC=C2 |
Computed by PubChem (NCBI)