Products 855198-83-3

CAS 855198-83-3 is the registry number for 4-(Cyclopentylsulfanyl)benzoic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 10g, 5g, 25g.

Structural formula: {0} (CAS {1})

4-cyclopentylsulfanylbenzoic acid (CAS 855198-83-3) is a chemical compound with the molecular formula C12H14O2S and a molecular weight of 222.31 g/mol. IUPAC name: 4-cyclopentylsulfanylbenzoic acid. InChIKey: LUPXZOGBGAFZNK-UHFFFAOYSA-N.

Identity
Molecular formulaC12H14O2S
Molecular weight222.31 g/mol
IUPAC name4-cyclopentylsulfanylbenzoic acid
InChIKeyLUPXZOGBGAFZNK-UHFFFAOYSA-N
SMILESC1CCC(C1)SC2=CC=C(C=C2)C(=O)O

Computed by PubChem (NCBI)