CAS 855198-83-3 is the registry number for 4-(Cyclopentylsulfanyl)benzoic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 10g, 5g, 25g.
4-cyclopentylsulfanylbenzoic acid (CAS 855198-83-3) is a chemical compound with the molecular formula C12H14O2S and a molecular weight of 222.31 g/mol. IUPAC name: 4-cyclopentylsulfanylbenzoic acid. InChIKey: LUPXZOGBGAFZNK-UHFFFAOYSA-N.
| Molecular formula | C12H14O2S |
|---|---|
| Molecular weight | 222.31 g/mol |
| IUPAC name | 4-cyclopentylsulfanylbenzoic acid |
| InChIKey | LUPXZOGBGAFZNK-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)SC2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)