Products 95175-52-3

CAS 95175-52-3 is the registry number for 2-Phenylsulfanylethyl 2-methylprop-2-enoate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

2-phenylsulfanylethyl 2-methylprop-2-enoate (CAS 95175-52-3) is a chemical compound with the molecular formula C12H14O2S and a molecular weight of 222.31 g/mol. IUPAC name: 2-phenylsulfanylethyl 2-methylprop-2-enoate. InChIKey: UUINCVLPONNTGX-UHFFFAOYSA-N.

Identity
Molecular formulaC12H14O2S
Molecular weight222.31 g/mol
IUPAC name2-phenylsulfanylethyl 2-methylprop-2-enoate
InChIKeyUUINCVLPONNTGX-UHFFFAOYSA-N
SMILESCC(=C)C(=O)OCCSC1=CC=CC=C1

Computed by PubChem (NCBI)