Products 57598-32-0
CAS 57598-32-0 is the registry number for 2-(2,3-Dimethoxyphenyl)-4,5-dihydro-4,4-dimethyloxazole, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-(2,3-dimethoxyphenyl)-4,4-dimethyl-5H-1,3-oxazole (CAS 57598-32-0) is a chemical compound with the molecular formula C13H17NO3 and a molecular weight of 235.28 g/mol. IUPAC name: 2-(2,3-dimethoxyphenyl)-4,4-dimethyl-5H-1,3-oxazole. InChIKey: GTXIBCRXNKXKCF-UHFFFAOYSA-N.
| Molecular formula | C13H17NO3 |
|---|---|
| Molecular weight | 235.28 g/mol |
| IUPAC name | 2-(2,3-dimethoxyphenyl)-4,4-dimethyl-5H-1,3-oxazole |
| InChIKey | GTXIBCRXNKXKCF-UHFFFAOYSA-N |
| SMILES | CC1(COC(=N1)C2=C(C(=CC=C2)OC)OC)C |
Computed by PubChem (NCBI)