CAS 57639-16-4 appears in our catalog under these names: 5–Bromo–3–phenyl–1H–indazole, 5-Bromo-3-phenyl-1H-indazole, 95%, 95%, 5-BROMO-3-PHENYL-1H-INDAZOLE, 95%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
5-bromo-3-phenyl-1H-indazole (CAS 57639-16-4) is a chemical compound with the molecular formula C13H9BrN2 and a molecular weight of 273.13 g/mol. IUPAC name: 5-bromo-3-phenyl-1H-indazole. InChIKey: QXKKPVVOOWBLND-UHFFFAOYSA-N.
| Molecular formula | C13H9BrN2 |
|---|---|
| Molecular weight | 273.13 g/mol |
| IUPAC name | 5-bromo-3-phenyl-1H-indazole |
| InChIKey | QXKKPVVOOWBLND-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NNC3=C2C=C(C=C3)Br |
Computed by PubChem (NCBI)