CAS 57646-06-7 is the registry number for 7-Hydroxy-3-methylchroman-4-one, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
7-hydroxy-3-methyl-2,3-dihydrochromen-4-one (CAS 57646-06-7) is a chemical compound with the molecular formula C10H10O3 and a molecular weight of 178.18 g/mol. IUPAC name: 7-hydroxy-3-methyl-2,3-dihydrochromen-4-one. InChIKey: QTBXSZPKOQHYAU-UHFFFAOYSA-N.
| Molecular formula | C10H10O3 |
|---|---|
| Molecular weight | 178.18 g/mol |
| IUPAC name | 7-hydroxy-3-methyl-2,3-dihydrochromen-4-one |
| InChIKey | QTBXSZPKOQHYAU-UHFFFAOYSA-N |
| SMILES | CC1COC2=C(C1=O)C=CC(=C2)O |
Computed by PubChem (NCBI)