CAS 577-72-0 appears in our catalog under these names: 4-Methoxy-3-nitroaniline, 98%, 4-Methoxy-3-nitroaniline, 4–Methoxy–3–nitroaniline, 4-Methoxy-3-nitroaniline 98%, 4-Methoxy-3-nitroaniline, 98%, 98%. Offered by: Combi-blocks, Chemat Brand, GLPBio, Biosynth, Ambeed. Available pack sizes: 10g, 25g, 1g, 100g, 5g, on request, 50g, 500g.
4-methoxy-3-nitroaniline (CAS 577-72-0) is a chemical compound with the molecular formula C7H8N2O3 and a molecular weight of 168.15 g/mol. IUPAC name: 4-methoxy-3-nitroaniline. InChIKey: RUFOHZDEBFYQSV-UHFFFAOYSA-N.
| Molecular formula | C7H8N2O3 |
|---|---|
| Molecular weight | 168.15 g/mol |
| IUPAC name | 4-methoxy-3-nitroaniline |
| InChIKey | RUFOHZDEBFYQSV-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)N)[N+](=O)[O-] |
Computed by PubChem (NCBI)