CAS 57704-10-6 appears in our catalog under these names: (S)-Bufuralol HCl, Bufuralol Impurity 2((S)-Bufuralol HCl), (S)-Bufuralol Hydrochloride. Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 1mg, 5mg.
(1S)-2-(tert-butylamino)-1-(7-ethyl-1-benzofuran-2-yl)ethanol;hydrochloride (CAS 57704-10-6) is a chemical compound with the molecular formula C16H24ClNO2 and a molecular weight of 297.82 g/mol. IUPAC name: (1S)-2-(tert-butylamino)-1-(7-ethyl-1-benzofuran-2-yl)ethanol;hydrochloride. InChIKey: KJBONRGCLLBWCJ-ZOWNYOTGSA-N.
| Molecular formula | C16H24ClNO2 |
|---|---|
| Molecular weight | 297.82 g/mol |
| IUPAC name | (1S)-2-(tert-butylamino)-1-(7-ethyl-1-benzofuran-2-yl)ethanol;hydrochloride |
| InChIKey | KJBONRGCLLBWCJ-ZOWNYOTGSA-N |
| SMILES | CCC1=CC=CC2=C1OC(=C2)[C@H](CNC(C)(C)C)O.Cl |
Computed by PubChem (NCBI)