CAS 57709-75-8 is the registry number for 2–Phenyl–4–(p–tolyl)phthalazin–1(2H)–one. Offered by: GLPBio. Available pack sizes: 1g, 250mg.
4-(4-methylphenyl)-2-phenylphthalazin-1-one (CAS 57709-75-8) is a chemical compound with the molecular formula C21H16N2O and a molecular weight of 312.4 g/mol. IUPAC name: 4-(4-methylphenyl)-2-phenylphthalazin-1-one. InChIKey: CBTVLLOUYLFHAI-UHFFFAOYSA-N.
| Molecular formula | C21H16N2O |
|---|---|
| Molecular weight | 312.4 g/mol |
| IUPAC name | 4-(4-methylphenyl)-2-phenylphthalazin-1-one |
| InChIKey | CBTVLLOUYLFHAI-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=NN(C(=O)C3=CC=CC=C32)C4=CC=CC=C4 |
Computed by PubChem (NCBI)