Products 66866-31-7
CAS 66866-31-7 is the registry number for 1-Benzyl-2-phenylquinazolin-4(1H)-one. Offered by: Biosynth. Available pack sizes: 5000mg, 10000mg.
1-benzyl-2-phenylquinazolin-4-one (CAS 66866-31-7) is a chemical compound with the molecular formula C21H16N2O and a molecular weight of 312.4 g/mol. IUPAC name: 1-benzyl-2-phenylquinazolin-4-one. InChIKey: JGDXZQYGBDBJRD-UHFFFAOYSA-N.
| Molecular formula | C21H16N2O |
|---|---|
| Molecular weight | 312.4 g/mol |
| IUPAC name | 1-benzyl-2-phenylquinazolin-4-one |
| InChIKey | JGDXZQYGBDBJRD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN2C3=CC=CC=C3C(=O)N=C2C4=CC=CC=C4 |
Computed by PubChem (NCBI)