CAS 607-56-7 is the registry number for 1,3-Di(naphthalen-1-yl)urea, 98%, 98%. Offered by: Chemat. Available pack sizes: 100mg.
1,3-dinaphthalen-1-ylurea (CAS 607-56-7) is a chemical compound with the molecular formula C21H16N2O and a molecular weight of 312.4 g/mol. IUPAC name: 1,3-dinaphthalen-1-ylurea. InChIKey: OAXACVUBJMHKTD-UHFFFAOYSA-N.
| Molecular formula | C21H16N2O |
|---|---|
| Molecular weight | 312.4 g/mol |
| IUPAC name | 1,3-dinaphthalen-1-ylurea |
| InChIKey | OAXACVUBJMHKTD-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC=C2NC(=O)NC3=CC=CC4=CC=CC=C43 |
Computed by PubChem (NCBI)