CAS 57768-13-5 is the registry number for Methyl 5,6-Dimethyl-3-phenylpicolinate. Offered by: TRC, Biosynth. Available pack sizes: 100mg.
Methyl 5,6-dimethyl-3-phenylpyridine-2-carboxylate (CAS 57768-13-5) is a chemical compound with the molecular formula C15H15NO2 and a molecular weight of 241.28 g/mol. IUPAC name: methyl 5,6-dimethyl-3-phenylpyridine-2-carboxylate. InChIKey: JROYQVJOLHALMS-UHFFFAOYSA-N.
| Molecular formula | C15H15NO2 |
|---|---|
| Molecular weight | 241.28 g/mol |
| IUPAC name | methyl 5,6-dimethyl-3-phenylpyridine-2-carboxylate |
| InChIKey | JROYQVJOLHALMS-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(N=C1C)C(=O)OC)C2=CC=CC=C2 |
Computed by PubChem (NCBI)