Products 57768-13-5

CAS 57768-13-5 is the registry number for Methyl 5,6-Dimethyl-3-phenylpicolinate. Offered by: TRC, Biosynth. Available pack sizes: 100mg.

Structural formula: {0} (CAS {1})

Methyl 5,6-dimethyl-3-phenylpyridine-2-carboxylate (CAS 57768-13-5) is a chemical compound with the molecular formula C15H15NO2 and a molecular weight of 241.28 g/mol. IUPAC name: methyl 5,6-dimethyl-3-phenylpyridine-2-carboxylate. InChIKey: JROYQVJOLHALMS-UHFFFAOYSA-N.

Identity
Molecular formulaC15H15NO2
Molecular weight241.28 g/mol
IUPAC namemethyl 5,6-dimethyl-3-phenylpyridine-2-carboxylate
InChIKeyJROYQVJOLHALMS-UHFFFAOYSA-N
SMILESCC1=CC(=C(N=C1C)C(=O)OC)C2=CC=CC=C2

Computed by PubChem (NCBI)