CAS 577778-86-0 is the registry number for 4-(2-(tert-Butoxycarbonyl)hydrazine-1-carbonyl)pyridine 1-oxide, 95%, 95%. Offered by: Chemat. Available pack sizes: 5g, 10g, 25g, 100g, 500g.
Tert-butyl N-[(1-oxidopyridin-1-ium-4-carbonyl)amino]carbamate (CAS 577778-86-0) is a chemical compound with the molecular formula C11H15N3O4 and a molecular weight of 253.25 g/mol. IUPAC name: tert-butyl N-[(1-oxidopyridin-1-ium-4-carbonyl)amino]carbamate. InChIKey: CSFUUUAPTXTBPN-UHFFFAOYSA-N.
| Molecular formula | C11H15N3O4 |
|---|---|
| Molecular weight | 253.25 g/mol |
| IUPAC name | tert-butyl N-[(1-oxidopyridin-1-ium-4-carbonyl)amino]carbamate |
| InChIKey | CSFUUUAPTXTBPN-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NNC(=O)C1=CC=[N+](C=C1)[O-] |
Computed by PubChem (NCBI)