CAS 57796-98-2 is the registry number for Zolpidem tartrate Impurity 10. Offered by: Chemat Brand. Available pack sizes: on request.
(E)-N,N-dimethyl-4-oxo-4-phenylbut-2-enamide (CAS 57796-98-2) is a chemical compound with the molecular formula C12H13NO2 and a molecular weight of 203.24 g/mol. IUPAC name: (E)-N,N-dimethyl-4-oxo-4-phenylbut-2-enamide. InChIKey: NSNDKERNOWOHGR-CMDGGOBGSA-N.
| Molecular formula | C12H13NO2 |
|---|---|
| Molecular weight | 203.24 g/mol |
| IUPAC name | (E)-N,N-dimethyl-4-oxo-4-phenylbut-2-enamide |
| InChIKey | NSNDKERNOWOHGR-CMDGGOBGSA-N |
| SMILES | CN(C)C(=O)/C=C/C(=O)C1=CC=CC=C1 |
Computed by PubChem (NCBI)