CAS 57880-12-3 is the registry number for 2-tert-Butyl-4-methyl-1H-indole, 95%. Offered by: Fluorochem. Available pack sizes: 1g, 5g.
2-tert-butyl-4-methyl-1H-indole (CAS 57880-12-3) is a chemical compound with the molecular formula C13H17N and a molecular weight of 187.28 g/mol. IUPAC name: 2-tert-butyl-4-methyl-1H-indole. InChIKey: CAWMRDGUUBKNRS-UHFFFAOYSA-N.
| Molecular formula | C13H17N |
|---|---|
| Molecular weight | 187.28 g/mol |
| IUPAC name | 2-tert-butyl-4-methyl-1H-indole |
| InChIKey | CAWMRDGUUBKNRS-UHFFFAOYSA-N |
| SMILES | CC1=C2C=C(NC2=CC=C1)C(C)(C)C |
Computed by PubChem (NCBI)