CAS 57908-47-1 is the registry number for 1,1′-Diacetoxy-1,1′-diphenyl-1,1′-azoethane, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
[1-[(E)-(1-acetyloxy-1-phenylethyl)diazenyl]-1-phenylethyl] acetate (CAS 57908-47-1) is a chemical compound with the molecular formula C20H22N2O4 and a molecular weight of 354.4 g/mol. IUPAC name: [1-[(E)-(1-acetyloxy-1-phenylethyl)diazenyl]-1-phenylethyl] acetate. InChIKey: ALBJGICXDBJZGK-QURGRASLSA-N.
| Molecular formula | C20H22N2O4 |
|---|---|
| Molecular weight | 354.4 g/mol |
| IUPAC name | [1-[(E)-(1-acetyloxy-1-phenylethyl)diazenyl]-1-phenylethyl] acetate |
| InChIKey | ALBJGICXDBJZGK-QURGRASLSA-N |
| SMILES | CC(=O)OC(C)(C1=CC=CC=C1)/N=N/C(C)(C2=CC=CC=C2)OC(=O)C |
Computed by PubChem (NCBI)