CAS 57961-50-9 appears in our catalog under these names: Ethyl 4-(2,5-dimethylphenyl)-2,4-dioxobutanoate, 95%, Ethyl 4-(2,5-dimethylphenyl)-2,4-dioxobutanoate, Ethyl 4-(2,5-dimethylphenyl)-2,4-dioxobutanoate, 95%, 95%, ethyl 4-(2,5-dimethylphenyl)-2-hydroxy-4-oxobut-2-enoate, 95%. Offered by: AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 2,5g, 250mg, 100mg, 500mg, 1g, 2.5g.
Ethyl 4-(2,5-dimethylphenyl)-2,4-dioxobutanoate (CAS 57961-50-9) is a chemical compound with the molecular formula C14H16O4 and a molecular weight of 248.27 g/mol. IUPAC name: ethyl 4-(2,5-dimethylphenyl)-2,4-dioxobutanoate. InChIKey: FRMKYUXSGRBHMC-UHFFFAOYSA-N.
| Molecular formula | C14H16O4 |
|---|---|
| Molecular weight | 248.27 g/mol |
| IUPAC name | ethyl 4-(2,5-dimethylphenyl)-2,4-dioxobutanoate |
| InChIKey | FRMKYUXSGRBHMC-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(=O)CC(=O)C1=C(C=CC(=C1)C)C |
Computed by PubChem (NCBI)