CAS 5805-42-5 appears in our catalog under these names: 2-Ethyl-6-nitro-1H-1,3-benzodiazole, 95%, 2-Ethyl-6-nitro-1H-1,3-benzodiazole. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
2-ethyl-6-nitro-1H-benzimidazole (CAS 5805-42-5) is a chemical compound with the molecular formula C9H9N3O2 and a molecular weight of 191.19 g/mol. IUPAC name: 2-ethyl-6-nitro-1H-benzimidazole. InChIKey: AAJAEEPAUQTYFB-UHFFFAOYSA-N.
| Molecular formula | C9H9N3O2 |
|---|---|
| Molecular weight | 191.19 g/mol |
| IUPAC name | 2-ethyl-6-nitro-1H-benzimidazole |
| InChIKey | AAJAEEPAUQTYFB-UHFFFAOYSA-N |
| SMILES | CCC1=NC2=C(N1)C=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)