CAS 58110-89-7 is the registry number for 1-(2-(Benzyloxy)-4-methylphenyl)ethan-1-one. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
1-(4-methyl-2-phenylmethoxyphenyl)ethanone (CAS 58110-89-7) is a chemical compound with the molecular formula C16H16O2 and a molecular weight of 240.30 g/mol. IUPAC name: 1-(4-methyl-2-phenylmethoxyphenyl)ethanone. InChIKey: CLKKXBAHOASWCP-UHFFFAOYSA-N.
| Molecular formula | C16H16O2 |
|---|---|
| Molecular weight | 240.30 g/mol |
| IUPAC name | 1-(4-methyl-2-phenylmethoxyphenyl)ethanone |
| InChIKey | CLKKXBAHOASWCP-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C(=O)C)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)