CAS 5814-41-5 appears in our catalog under these names: 5,10-Dihydro-11H-dibenzo(b,e)(1,4)diazepin-11-one, 98%, 5H–Dibenzo(b，e)(1，4)diazepin–11(10H)–one, 5,10-Dihydro-11H-dibenzo[b,e][1,4]diazepin-11-one 98%, 5,10-Dihydro-11H-dibenzo[b,e][1,4]diazepin-11-one, 98%, 98%, Clozapine impurity 8, 99.38%. Offered by: AmBeed, GLPBio, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 10g, 100mg, 1g, 250mg, 5g, 5 mg.
5,11-dihydrobenzo[b][1,4]benzodiazepin-6-one (CAS 5814-41-5) is a chemical compound with the molecular formula C13H10N2O and a molecular weight of 210.23 g/mol. IUPAC name: 5,11-dihydrobenzo[b][1,4]benzodiazepin-6-one. InChIKey: KVVFXAAMMFTLGN-UHFFFAOYSA-N.
| Molecular formula | C13H10N2O |
|---|---|
| Molecular weight | 210.23 g/mol |
| IUPAC name | 5,11-dihydrobenzo[b][1,4]benzodiazepin-6-one |
| InChIKey | KVVFXAAMMFTLGN-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)NC3=CC=CC=C3N2 |
Computed by PubChem (NCBI)