CAS 5824-40-8 appears in our catalog under these names: Triphenylmethylamine, >95% (HPLC), Triphenylmethylamine, Tritylamine/ 98%, Tritylamine, 98% , Tritylamine. Offered by: TRC, GLPBio, Chemat, Thermo Scientific (Alfa Aesar), Biosynth. Available pack sizes: 250g, 25g, 5g, 100g, 500g, 10g, 2g, 1g.
Triphenylmethanamine (CAS 5824-40-8) is a chemical compound with the molecular formula C19H17N and a molecular weight of 259.3 g/mol. IUPAC name: triphenylmethanamine. InChIKey: BZVJOYBTLHNRDW-UHFFFAOYSA-N.
| Molecular formula | C19H17N |
|---|---|
| Molecular weight | 259.3 g/mol |
| IUPAC name | triphenylmethanamine |
| InChIKey | BZVJOYBTLHNRDW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=CC=C3)N |
Computed by PubChem (NCBI)