Products 73842-48-5

CAS 73842-48-5 is the registry number for N-Benzyl-(1,1'-biphenyl)-4-amine, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g, 25g.

Structural formula: {0} (CAS {1})

N-benzyl-4-phenylaniline (CAS 73842-48-5) is a chemical compound with the molecular formula C19H17N and a molecular weight of 259.3 g/mol. IUPAC name: N-benzyl-4-phenylaniline. InChIKey: PNMICSCKJWXRKQ-UHFFFAOYSA-N.

Identity
Molecular formulaC19H17N
Molecular weight259.3 g/mol
IUPAC nameN-benzyl-4-phenylaniline
InChIKeyPNMICSCKJWXRKQ-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)CNC2=CC=C(C=C2)C3=CC=CC=C3

Computed by PubChem (NCBI)