CAS 73842-48-5 is the registry number for N-Benzyl-(1,1'-biphenyl)-4-amine, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g, 25g.
N-benzyl-4-phenylaniline (CAS 73842-48-5) is a chemical compound with the molecular formula C19H17N and a molecular weight of 259.3 g/mol. IUPAC name: N-benzyl-4-phenylaniline. InChIKey: PNMICSCKJWXRKQ-UHFFFAOYSA-N.
| Molecular formula | C19H17N |
|---|---|
| Molecular weight | 259.3 g/mol |
| IUPAC name | N-benzyl-4-phenylaniline |
| InChIKey | PNMICSCKJWXRKQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CNC2=CC=C(C=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)