CAS 606-87-1 appears in our catalog under these names: N-Benzyl-n-phenylaniline, 95%, N-Benzyl-N-phenylaniline 95%, N-BENZYL-N-PHENYLANILINE, 98%. Offered by: Combi-blocks, Ambeed, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 25g, 100g, 500g, 5g.
N-benzyl-N-phenylaniline (CAS 606-87-1) is a chemical compound with the molecular formula C19H17N and a molecular weight of 259.3 g/mol. IUPAC name: N-benzyl-N-phenylaniline. InChIKey: FKJARBPQBIATJT-UHFFFAOYSA-N.
| Molecular formula | C19H17N |
|---|---|
| Molecular weight | 259.3 g/mol |
| IUPAC name | N-benzyl-N-phenylaniline |
| InChIKey | FKJARBPQBIATJT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN(C2=CC=CC=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)