CAS 58336-35-9 appears in our catalog under these names: 2,3,5,6-1H,4H-Tetrahydroquinolizino[9,9a,1-gh]coumarin, 95%, LD 490, Coumarin 6H, Coumarin 6H, >96.0%(HPLC)(T), 2,3,5,6-1H,4H-Tetrahydroquinolizino[9,9a,1-gh]coumarin, 98%, 98%. Offered by: Combi-blocks, TargetMol, GLPBio, TCI, Chemat. Available pack sizes: 1g, 200mg, 5mg, 10mg, 100mg, 250mg, 50mg, 50 mg.
3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,5,7,9(17)-tetraen-4-one (CAS 58336-35-9) is a chemical compound with the molecular formula C15H15NO2 and a molecular weight of 241.28 g/mol. IUPAC name: 3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,5,7,9(17)-tetraen-4-one. InChIKey: MZSOXGPKUOAXNY-UHFFFAOYSA-N.
| Molecular formula | C15H15NO2 |
|---|---|
| Molecular weight | 241.28 g/mol |
| IUPAC name | 3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,5,7,9(17)-tetraen-4-one |
| InChIKey | MZSOXGPKUOAXNY-UHFFFAOYSA-N |
| SMILES | C1CC2=C3C(=C4C(=C2)C=CC(=O)O4)CCCN3C1 |
Computed by PubChem (NCBI)