CAS 58337-35-2 is the registry number for Elliptinium (acetate). Offered by: MedChemExpress. Available pack sizes: Get quote.
2,5,11-trimethyl-6H-pyrido[4,3-b]carbazol-2-ium-9-ol acetate (CAS 58337-35-2) is a chemical compound with the molecular formula C20H20N2O3 and a molecular weight of 336.4 g/mol. IUPAC name: 2,5,11-trimethyl-6H-pyrido[4,3-b]carbazol-2-ium-9-ol acetate. InChIKey: BOMZMNZEXMAQQW-UHFFFAOYSA-N.
| Molecular formula | C20H20N2O3 |
|---|---|
| Molecular weight | 336.4 g/mol |
| IUPAC name | 2,5,11-trimethyl-6H-pyrido[4,3-b]carbazol-2-ium-9-ol acetate |
| InChIKey | BOMZMNZEXMAQQW-UHFFFAOYSA-N |
| SMILES | CC1=C2C=C[N+](=CC2=C(C3=C1NC4=C3C=C(C=C4)O)C)C.CC(=O)[O-] |
Computed by PubChem (NCBI)