CAS 58501-47-6 is the registry number for L-Homohistidine. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 250mg.
(2S)-2-amino-4-(1H-imidazol-5-yl)butanoic acid (CAS 58501-47-6) is a chemical compound with the molecular formula C7H11N3O2 and a molecular weight of 169.18 g/mol. IUPAC name: (2S)-2-amino-4-(1H-imidazol-5-yl)butanoic acid. InChIKey: MSECZMWQBBVGEN-LURJTMIESA-N.
| Molecular formula | C7H11N3O2 |
|---|---|
| Molecular weight | 169.18 g/mol |
| IUPAC name | (2S)-2-amino-4-(1H-imidazol-5-yl)butanoic acid |
| InChIKey | MSECZMWQBBVGEN-LURJTMIESA-N |
| SMILES | C1=C(NC=N1)CC[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)