CAS 58633-04-8 appears in our catalog under these names: 4–Amino–3,5–dibromobenzonitrile, 4-Amino-3,5-dibromobenzonitrile 95%, 4-Amino-3,5-dibromobenzonitrile, 95%, 95%, 4-Amino-3,5-dibromobenzonitrile, 95%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 25g, 250mg, 1g, 5g, 100g, 500g, 50g.
4-amino-3,5-dibromobenzonitrile (CAS 58633-04-8) is a chemical compound with the molecular formula C7H4Br2N2 and a molecular weight of 275.93 g/mol. IUPAC name: 4-amino-3,5-dibromobenzonitrile. InChIKey: UWIGJWZPRNWPBK-UHFFFAOYSA-N.
| Molecular formula | C7H4Br2N2 |
|---|---|
| Molecular weight | 275.93 g/mol |
| IUPAC name | 4-amino-3,5-dibromobenzonitrile |
| InChIKey | UWIGJWZPRNWPBK-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Br)N)Br)C#N |
Computed by PubChem (NCBI)