CAS 58645-20-8 appears in our catalog under these names: 2,3,4,6-Tetra-O-acetyl-D-mannopyranose, >95% (HPLC), 2,3,4,6-Tetra-O-acetyl-D-mannopyranose. Offered by: TRC, Biosynth. Available pack sizes: 1g, 500mg, 2g, 5g, 25g, 10g.
[(2R,3R,4S,5S)-3,4,5-triacetyloxy-6-hydroxyoxan-2-yl]methyl acetate (CAS 58645-20-8) is a chemical compound with the molecular formula C14H20O10 and a molecular weight of 348.30 g/mol. IUPAC name: [(2R,3R,4S,5S)-3,4,5-triacetyloxy-6-hydroxyoxan-2-yl]methyl acetate. InChIKey: IEOLRPPTIGNUNP-JABUTEAWSA-N.
| Molecular formula | C14H20O10 |
|---|---|
| Molecular weight | 348.30 g/mol |
| IUPAC name | [(2R,3R,4S,5S)-3,4,5-triacetyloxy-6-hydroxyoxan-2-yl]methyl acetate |
| InChIKey | IEOLRPPTIGNUNP-JABUTEAWSA-N |
| SMILES | CC(=O)OC[C@@H]1[C@H]([C@@H]([C@@H](C(O1)O)OC(=O)C)OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)