CAS 6207-76-7 appears in our catalog under these names: (2R,3R,4S,5R,6S)-2-(Acetoxymethyl)-6-hydroxytetrahydro-2H-pyran-3,4,5-triyl triacetate, 95%, Gastrodin Impurity 6, 2,3,4,6-Tetra-O-acetyl-a-D-glucopyranose. Offered by: Chemat Brand, Hubei YoungXin, Biosynth. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 5g, 1g.
[(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-hydroxyoxan-2-yl]methyl acetate (CAS 6207-76-7) is a chemical compound with the molecular formula C14H20O10 and a molecular weight of 348.30 g/mol. IUPAC name: [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-hydroxyoxan-2-yl]methyl acetate. InChIKey: IEOLRPPTIGNUNP-RGDJUOJXSA-N.
| Molecular formula | C14H20O10 |
|---|---|
| Molecular weight | 348.30 g/mol |
| IUPAC name | [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-hydroxyoxan-2-yl]methyl acetate |
| InChIKey | IEOLRPPTIGNUNP-RGDJUOJXSA-N |
| SMILES | CC(=O)OC[C@@H]1[C@H]([C@@H]([C@H]([C@H](O1)O)OC(=O)C)OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)