Products 58750-65-5
CAS 58750-65-5 is the registry number for 2,2-Difluoro-1-(1H-indol-3-yl)ethan-1-one, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g, 25g.
2,2-difluoro-1-(1H-indol-3-yl)ethanone (CAS 58750-65-5) is a chemical compound with the molecular formula C10H7F2NO and a molecular weight of 195.16 g/mol. IUPAC name: 2,2-difluoro-1-(1H-indol-3-yl)ethanone. InChIKey: IITUTLRLYXRFKG-UHFFFAOYSA-N.
| Molecular formula | C10H7F2NO |
|---|---|
| Molecular weight | 195.16 g/mol |
| IUPAC name | 2,2-difluoro-1-(1H-indol-3-yl)ethanone |
| InChIKey | IITUTLRLYXRFKG-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN2)C(=O)C(F)F |
Computed by PubChem (NCBI)