CAS 1889534-40-0 is the registry number for 5-(2,4-Difluorophenyl)-3-methylisoxazole, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-(2,4-difluorophenyl)-3-methyl-1,2-oxazole (CAS 1889534-40-0) is a chemical compound with the molecular formula C10H7F2NO and a molecular weight of 195.16 g/mol. IUPAC name: 5-(2,4-difluorophenyl)-3-methyl-1,2-oxazole. InChIKey: JGUUIBQOUHXHJD-UHFFFAOYSA-N.
| Molecular formula | C10H7F2NO |
|---|---|
| Molecular weight | 195.16 g/mol |
| IUPAC name | 5-(2,4-difluorophenyl)-3-methyl-1,2-oxazole |
| InChIKey | JGUUIBQOUHXHJD-UHFFFAOYSA-N |
| SMILES | CC1=NOC(=C1)C2=C(C=C(C=C2)F)F |
Computed by PubChem (NCBI)